C12H10Cl2N2O3 — CID 61000631
5-(3,4-dichlorophenoxy)-1,3-dimethylpyrazole-4-carboxylic acid (PubChem CID 61000631) has the molecular formula C12H10Cl2N2O3 and a molecular weight of 301.13 g/mol. Its IUPAC name is 5-(3,4-dichlorophenoxy)-1,3-dimethylpyrazole-4-carboxylic acid.
| Compound Name | 5-(3,4-dichlorophenoxy)-1,3-dimethylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 61000631 |
| Molecular Formula | C12H10Cl2N2O3 |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 5-(3,4-dichlorophenoxy)-1,3-dimethylpyrazole-4-carboxylic acid |
| SMILES | Cc1nn(C)c(Oc2ccc(Cl)c(Cl)c2)c1C(=O)O |
| InChI | InChI=1S/C12H10Cl2N2O3/c1-6-10(12(17)18)11(16(2)15-6)19-7-3-4-8(13)9(14)5-7/h3-5H,1-2H3,(H,17,18) |
| InChIKey | LKDYZHBDQJVHEO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |