About CID 11028273
CID 11028273 (PubChem CID 11028273) has the molecular formula C30H27N2O3Sn
and a molecular weight of 582.27 g/mol.
Molecular Properties
| Compound Name | CID 11028273 |
| PubChem CID | 11028273 |
| Molecular Formula | C30H27N2O3Sn |
| Molecular Weight | 582.27 g/mol |
| Exact Mass | 583.10 |
| IUPAC Name | — |
| SMILES | Cc1nn(C)c(Oc2ccccc2)c1C(=O)O.c1ccc([Sn](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C12H12N2O3.3C6H5.Sn/c1-8-10(12(15)16)11(14(2)13-8)17-9-6-4-3-5-7-9;3*1-2-4-6-5-3-1;/h3-7H,1-2H3,(H,15,16);3*1-5H; |
| InChIKey | ULYROYQKXBFUNL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 582.27 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 11028273 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11028273?
The IUPAC name of CID 11028273 (CID 11028273) is not available.
What is the SMILES notation for CID 11028273?
The canonical SMILES for CID 11028273 is Cc1nn(C)c(Oc2ccccc2)c1C(=O)O.c1ccc([Sn](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of CID 11028273?
The InChIKey is ULYROYQKXBFUNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O3.3C6H5.Sn/c1-8-10(12(15)16)11(14(2)13-8)17-9-6-4-3-5-7-9;3*1-2-4-6-5-3-1;/h3-7H,1-2H3,(H,15,16);3*1-5H;.
What are the key properties of CID 11028273?
CID 11028273 has a molecular weight of 582.27 g/mol, XLogP of 4.42, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11028273 is sourced from PubChem (CID 11028273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).