C13H8F6N2O3 — CID 2775696
1-methyl-3-(trifluoromethyl)-5-[3-(trifluoromethyl)phenoxy]pyrazole-4-carboxylic acid (PubChem CID 2775696) has the molecular formula C13H8F6N2O3 and a molecular weight of 354.21 g/mol. Its IUPAC name is 1-methyl-3-(trifluoromethyl)-5-[3-(trifluoromethyl)phenoxy]pyrazole-4-carboxylic acid.
| Compound Name | 1-methyl-3-(trifluoromethyl)-5-[3-(trifluoromethyl)phenoxy]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 2775696 |
| Molecular Formula | C13H8F6N2O3 |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 1-methyl-3-(trifluoromethyl)-5-[3-(trifluoromethyl)phenoxy]pyrazole-4-carboxylic acid |
| SMILES | Cn1nc(C(F)(F)F)c(C(=O)O)c1Oc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H8F6N2O3/c1-21-10(8(11(22)23)9(20-21)13(17,18)19)24-7-4-2-3-6(5-7)12(14,15)16/h2-5H,1H3,(H,22,23) |
| InChIKey | VGTGQSZJFZSRTL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |