C29H30BN3O2 — CID 162689921
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-tritylpyrazin-2-amine (PubChem CID 162689921) has the molecular formula C29H30BN3O2 and a molecular weight of 463.39 g/mol. Its IUPAC name is 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-tritylpyrazin-2-amine.
| Compound Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-tritylpyrazin-2-amine |
|---|---|
| PubChem CID | 162689921 |
| Molecular Formula | C29H30BN3O2 |
| Molecular Weight | 463.39 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-tritylpyrazin-2-amine |
| SMILES | CC1(C)OB(c2cnc(NC(c3ccccc3)(c3ccccc3)c3ccccc3)cn2)OC1(C)C |
| InChI | InChI=1S/C29H30BN3O2/c1-27(2)28(3,4)35-30(34-27)25-20-32-26(21-31-25)33-29(22-14-8-5-9-15-22,23-16-10-6-11-17-23)24-18-12-7-13-19-24/h5-21H,1-4H3,(H,32,33) |
| InChIKey | FVKDQNFDEZAHNE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.39 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|