C12H13N3O2 — CID 54965994
5-(6-amino-2-oxo-1,3-benzoxazol-3-yl)pentanenitrile (PubChem CID 54965994) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 5-(6-amino-2-oxo-1,3-benzoxazol-3-yl)pentanenitrile.
| Compound Name | 5-(6-amino-2-oxo-1,3-benzoxazol-3-yl)pentanenitrile |
|---|---|
| PubChem CID | 54965994 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 5-(6-amino-2-oxo-1,3-benzoxazol-3-yl)pentanenitrile |
| SMILES | N#CCCCCn1c(=O)oc2cc(N)ccc21 |
| InChI | InChI=1S/C12H13N3O2/c13-6-2-1-3-7-15-10-5-4-9(14)8-11(10)17-12(15)16/h4-5,8H,1-3,7,14H2 |
| InChIKey | AMYSYFPCVJZCKE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|