C12H14N2O2 — CID 65458515
6-amino-3-(cyclobutylmethyl)-1,3-benzoxazol-2-one (PubChem CID 65458515) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 6-amino-3-(cyclobutylmethyl)-1,3-benzoxazol-2-one.
| Compound Name | 6-amino-3-(cyclobutylmethyl)-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 65458515 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 6-amino-3-(cyclobutylmethyl)-1,3-benzoxazol-2-one |
| SMILES | Nc1ccc2c(c1)oc(=O)n2CC1CCC1 |
| InChI | InChI=1S/C12H14N2O2/c13-9-4-5-10-11(6-9)16-12(15)14(10)7-8-2-1-3-8/h4-6,8H,1-3,7,13H2 |
| InChIKey | ARBROAFBIHJVHG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 61.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|