C9H8N2O4 — CID 61307519
2-(6-amino-2-oxo-1,3-benzoxazol-3-yl)acetic acid (PubChem CID 61307519) has the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. Its IUPAC name is 2-(6-amino-2-oxo-1,3-benzoxazol-3-yl)acetic acid.
| Compound Name | 2-(6-amino-2-oxo-1,3-benzoxazol-3-yl)acetic acid |
|---|---|
| PubChem CID | 61307519 |
| Molecular Formula | C9H8N2O4 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 2-(6-amino-2-oxo-1,3-benzoxazol-3-yl)acetic acid |
| SMILES | Nc1ccc2c(c1)oc(=O)n2CC(=O)O |
| InChI | InChI=1S/C9H8N2O4/c10-5-1-2-6-7(3-5)15-9(14)11(6)4-8(12)13/h1-3H,4,10H2,(H,12,13) |
| InChIKey | IGPQFRLKDYXUDJ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|