C13H17N3O3 — CID 43447892
2-(5-amino-2-oxo-1,3-benzoxazol-3-yl)-N,N-diethylacetamide (PubChem CID 43447892) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 2-(5-amino-2-oxo-1,3-benzoxazol-3-yl)-N,N-diethylacetamide.
| Compound Name | 2-(5-amino-2-oxo-1,3-benzoxazol-3-yl)-N,N-diethylacetamide |
|---|---|
| PubChem CID | 43447892 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 2-(5-amino-2-oxo-1,3-benzoxazol-3-yl)-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)Cn1c(=O)oc2ccc(N)cc21 |
| InChI | InChI=1S/C13H17N3O3/c1-3-15(4-2)12(17)8-16-10-7-9(14)5-6-11(10)19-13(16)18/h5-7H,3-4,8,14H2,1-2H3 |
| InChIKey | SWDQFCAHAQCZLB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|