C12H15N3O4 — CID 61487292
2-(5-amino-2-oxo-1,3-benzoxazol-3-yl)-N-(2-methoxyethyl)acetamide (PubChem CID 61487292) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is 2-(5-amino-2-oxo-1,3-benzoxazol-3-yl)-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-(5-amino-2-oxo-1,3-benzoxazol-3-yl)-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 61487292 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 2-(5-amino-2-oxo-1,3-benzoxazol-3-yl)-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)Cn1c(=O)oc2ccc(N)cc21 |
| InChI | InChI=1S/C12H15N3O4/c1-18-5-4-14-11(16)7-15-9-6-8(13)2-3-10(9)19-12(15)17/h2-3,6H,4-5,7,13H2,1H3,(H,14,16) |
| InChIKey | IQVRVZOHHIFPSX-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|