C10H10N6O2 — CID 107042825
6-amino-3-[(2-methyltetrazol-5-yl)methyl]-1,3-benzoxazol-2-one (PubChem CID 107042825) has the molecular formula C10H10N6O2 and a molecular weight of 246.23 g/mol. Its IUPAC name is 6-amino-3-[(2-methyltetrazol-5-yl)methyl]-1,3-benzoxazol-2-one.
| Compound Name | 6-amino-3-[(2-methyltetrazol-5-yl)methyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 107042825 |
| Molecular Formula | C10H10N6O2 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 6-amino-3-[(2-methyltetrazol-5-yl)methyl]-1,3-benzoxazol-2-one |
| SMILES | Cn1nnc(Cn2c(=O)oc3cc(N)ccc32)n1 |
| InChI | InChI=1S/C10H10N6O2/c1-15-13-9(12-14-15)5-16-7-3-2-6(11)4-8(7)18-10(16)17/h2-4H,5,11H2,1H3 |
| InChIKey | QGRPLMPGXHVCEP-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|