C15H10FN3O2 — CID 107905067
2-[(6-amino-2-oxo-1,3-benzoxazol-3-yl)methyl]-4-fluorobenzonitrile (PubChem CID 107905067) has the molecular formula C15H10FN3O2 and a molecular weight of 283.26 g/mol. Its IUPAC name is 2-[(6-amino-2-oxo-1,3-benzoxazol-3-yl)methyl]-4-fluorobenzonitrile.
| Compound Name | 2-[(6-amino-2-oxo-1,3-benzoxazol-3-yl)methyl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 107905067 |
| Molecular Formula | C15H10FN3O2 |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2-[(6-amino-2-oxo-1,3-benzoxazol-3-yl)methyl]-4-fluorobenzonitrile |
| SMILES | N#Cc1ccc(F)cc1Cn1c(=O)oc2cc(N)ccc21 |
| InChI | InChI=1S/C15H10FN3O2/c16-11-2-1-9(7-17)10(5-11)8-19-13-4-3-12(18)6-14(13)21-15(19)20/h1-6H,8,18H2 |
| InChIKey | NNJPUDTWAUJHOQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|