C14H8ClFINO2 — CID 79787910
3-[(2-chloro-4-fluorophenyl)methyl]-6-iodo-1,3-benzoxazol-2-one (PubChem CID 79787910) has the molecular formula C14H8ClFINO2 and a molecular weight of 403.58 g/mol. Its IUPAC name is 3-[(2-chloro-4-fluorophenyl)methyl]-6-iodo-1,3-benzoxazol-2-one.
| Compound Name | 3-[(2-chloro-4-fluorophenyl)methyl]-6-iodo-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 79787910 |
| Molecular Formula | C14H8ClFINO2 |
| Molecular Weight | 403.58 g/mol |
| Exact Mass | 402.93 |
| IUPAC Name | 3-[(2-chloro-4-fluorophenyl)methyl]-6-iodo-1,3-benzoxazol-2-one |
| SMILES | O=c1oc2cc(I)ccc2n1Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C14H8ClFINO2/c15-11-5-9(16)2-1-8(11)7-18-12-4-3-10(17)6-13(12)20-14(18)19/h1-6H,7H2 |
| InChIKey | WSQCEPLWJAIREB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.58 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|