C14H11ClN2O2 — CID 62100918
3-[(2-amino-4-chlorophenyl)methyl]-1,3-benzoxazol-2-one (PubChem CID 62100918) has the molecular formula C14H11ClN2O2 and a molecular weight of 274.71 g/mol. Its IUPAC name is 3-[(2-amino-4-chlorophenyl)methyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-[(2-amino-4-chlorophenyl)methyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 62100918 |
| Molecular Formula | C14H11ClN2O2 |
| Molecular Weight | 274.71 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 3-[(2-amino-4-chlorophenyl)methyl]-1,3-benzoxazol-2-one |
| SMILES | Nc1cc(Cl)ccc1Cn1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C14H11ClN2O2/c15-10-6-5-9(11(16)7-10)8-17-12-3-1-2-4-13(12)19-14(17)18/h1-7H,8,16H2 |
| InChIKey | WKVVRSARIBWLDR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 61.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.71 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|