C12H8ClN3O2 — CID 104513870
3-[(6-chloropyridazin-3-yl)methyl]-1,3-benzoxazol-2-one (PubChem CID 104513870) has the molecular formula C12H8ClN3O2 and a molecular weight of 261.67 g/mol. Its IUPAC name is 3-[(6-chloropyridazin-3-yl)methyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-[(6-chloropyridazin-3-yl)methyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 104513870 |
| Molecular Formula | C12H8ClN3O2 |
| Molecular Weight | 261.67 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | 3-[(6-chloropyridazin-3-yl)methyl]-1,3-benzoxazol-2-one |
| SMILES | O=c1oc2ccccc2n1Cc1ccc(Cl)nn1 |
| InChI | InChI=1S/C12H8ClN3O2/c13-11-6-5-8(14-15-11)7-16-9-3-1-2-4-10(9)18-12(16)17/h1-6H,7H2 |
| InChIKey | HGYYPUFBXOUCQW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.67 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |