C13H9ClN2O2 — CID 62470052
3-[(2-chloro-3-pyridinyl)methyl]-1,3-benzoxazol-2-one (PubChem CID 62470052) has the molecular formula C13H9ClN2O2 and a molecular weight of 260.68 g/mol. Its IUPAC name is 3-[(2-chloro-3-pyridinyl)methyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-[(2-chloro-3-pyridinyl)methyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 62470052 |
| Molecular Formula | C13H9ClN2O2 |
| Molecular Weight | 260.68 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 3-[(2-chloro-3-pyridinyl)methyl]-1,3-benzoxazol-2-one |
| SMILES | O=c1oc2ccccc2n1Cc1cccnc1Cl |
| InChI | InChI=1S/C13H9ClN2O2/c14-12-9(4-3-7-15-12)8-16-10-5-1-2-6-11(10)18-13(16)17/h1-7H,8H2 |
| InChIKey | CWKKXTQLBNPJLT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.68 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|