C15H9FN2O2 — CID 103759989
4-fluoro-2-[(2-oxo-1,3-benzoxazol-3-yl)methyl]benzonitrile (PubChem CID 103759989) has the molecular formula C15H9FN2O2 and a molecular weight of 268.25 g/mol. Its IUPAC name is 4-fluoro-2-[(2-oxo-1,3-benzoxazol-3-yl)methyl]benzonitrile.
| Compound Name | 4-fluoro-2-[(2-oxo-1,3-benzoxazol-3-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 103759989 |
| Molecular Formula | C15H9FN2O2 |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 4-fluoro-2-[(2-oxo-1,3-benzoxazol-3-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccc(F)cc1Cn1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C15H9FN2O2/c16-12-6-5-10(8-17)11(7-12)9-18-13-3-1-2-4-14(13)20-15(18)19/h1-7H,9H2 |
| InChIKey | SNRKDRBIPPJQOV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 58.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |