C16H12FN3O — CID 141343202
2-[(5-fluoro-3-methyl-2-oxobenzimidazol-1-yl)methyl]benzonitrile (PubChem CID 141343202) has the molecular formula C16H12FN3O and a molecular weight of 281.29 g/mol. Its IUPAC name is 2-[(5-fluoro-3-methyl-2-oxobenzimidazol-1-yl)methyl]benzonitrile.
| Compound Name | 2-[(5-fluoro-3-methyl-2-oxobenzimidazol-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 141343202 |
| Molecular Formula | C16H12FN3O |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 2-[(5-fluoro-3-methyl-2-oxobenzimidazol-1-yl)methyl]benzonitrile |
| SMILES | Cn1c(=O)n(Cc2ccccc2C#N)c2ccc(F)cc21 |
| InChI | InChI=1S/C16H12FN3O/c1-19-15-8-13(17)6-7-14(15)20(16(19)21)10-12-5-3-2-4-11(12)9-18/h2-8H,10H2,1H3 |
| InChIKey | XBLCXPDXYRSWMT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |