C18H21N5O2 — CID 76974260
6-[[6-[(3S)-3-aminopiperidin-1-yl]-3-methyl-2,4-dioxopyrimidin-1-yl]methyl](1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carbonitrile (PubChem CID 76974260) has the molecular formula C18H21N5O2 and a molecular weight of 345.35 g/mol. Its IUPAC name is 6-[[6-[(3S)-3-aminopiperidin-1-yl]-3-methyl-2,4-dioxopyrimidin-1-yl]methyl](1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carbonitrile.
| Compound Name | 6-[[6-[(3S)-3-aminopiperidin-1-yl]-3-methyl-2,4-dioxopyrimidin-1-yl]methyl](1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carbonitrile |
|---|---|
| PubChem CID | 76974260 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 6-[[6-[(3S)-3-aminopiperidin-1-yl]-3-methyl-2,4-dioxopyrimidin-1-yl]methyl](1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carbonitrile |
| SMILES | Cn1c(=O)cc(N2CCC[C@H](N)C2)n(C[13c]2[13cH][13cH][13cH][13cH][13c]2C#N)c1=O |
| InChI | InChI=1S/C18H21N5O2/c1-21-17(24)9-16(22-8-4-7-15(20)12-22)23(18(21)25)11-14-6-3-2-5-13(14)10-19/h2-3,5-6,9,15H,4,7-8,11-12,20H2,1H3/t15-/m0/s1/i2+1,3+1,5+1,6+1,13+1,14+1 |
| InChIKey | ZSBOMTDTBDDKMP-FKDKUYGGSA-N |
| XLogP | 0.39 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |