C20H21ClN6O — CID 53312325
2-[[7-[(3R)-3-aminopiperidin-1-yl]-5-chloro-3-methyl-2-oxoimidazo[4,5-b]pyridin-1-yl]methyl]benzonitrile (PubChem CID 53312325) has the molecular formula C20H21ClN6O and a molecular weight of 396.88 g/mol. Its IUPAC name is 2-[[7-[(3R)-3-aminopiperidin-1-yl]-5-chloro-3-methyl-2-oxoimidazo[4,5-b]pyridin-1-yl]methyl]benzonitrile.
| Compound Name | 2-[[7-[(3R)-3-aminopiperidin-1-yl]-5-chloro-3-methyl-2-oxoimidazo[4,5-b]pyridin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 53312325 |
| Molecular Formula | C20H21ClN6O |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 2-[[7-[(3R)-3-aminopiperidin-1-yl]-5-chloro-3-methyl-2-oxoimidazo[4,5-b]pyridin-1-yl]methyl]benzonitrile |
| SMILES | Cn1c(=O)n(Cc2ccccc2C#N)c2c(N3CCC[C@@H](N)C3)cc(Cl)nc21 |
| InChI | InChI=1S/C20H21ClN6O/c1-25-19-18(16(9-17(21)24-19)26-8-4-7-15(23)12-26)27(20(25)28)11-14-6-3-2-5-13(14)10-22/h2-3,5-6,9,15H,4,7-8,11-12,23H2,1H3/t15-/m1/s1 |
| InChIKey | WVXJEVYRQBPFTG-OAHLLOKOSA-N |
| XLogP | 2.24 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|