C19H26N5O2+ — CID 123229318
[2-[[6-(3-aminopiperidin-1-yl)-3-methyl-2,4-dioxopyrimidin-1-yl]methyl]phenyl]-methyl-methylideneazanium (PubChem CID 123229318) has the molecular formula C19H26N5O2+ and a molecular weight of 356.45 g/mol. Its IUPAC name is [2-[[6-(3-aminopiperidin-1-yl)-3-methyl-2,4-dioxopyrimidin-1-yl]methyl]phenyl]-methyl-methylideneazanium.
| Compound Name | [2-[[6-(3-aminopiperidin-1-yl)-3-methyl-2,4-dioxopyrimidin-1-yl]methyl]phenyl]-methyl-methylideneazanium |
|---|---|
| PubChem CID | 123229318 |
| Molecular Formula | C19H26N5O2+ |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | [2-[[6-(3-aminopiperidin-1-yl)-3-methyl-2,4-dioxopyrimidin-1-yl]methyl]phenyl]-methyl-methylideneazanium |
| SMILES | C=[N+](C)c1ccccc1Cn1c(N2CCCC(N)C2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C19H26N5O2/c1-21(2)16-9-5-4-7-14(16)12-24-17(11-18(25)22(3)19(24)26)23-10-6-8-15(20)13-23/h4-5,7,9,11,15H,1,6,8,10,12-13,20H2,2-3H3/q+1 |
| InChIKey | WFEOOXRAPHLLBA-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 76.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|