C18H23N5O2 — CID 144867733
(2Z)-3-[[6-[(3R)-3-aminopiperidin-1-yl]-3-methyl-2,4-dioxopyrimidin-1-yl]methyl]-2-ethenylpenta-2,4-dienenitrile (PubChem CID 144867733) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is (2Z)-3-[[6-[(3R)-3-aminopiperidin-1-yl]-3-methyl-2,4-dioxopyrimidin-1-yl]methyl]-2-ethenylpenta-2,4-dienenitrile.
| Compound Name | (2Z)-3-[[6-[(3R)-3-aminopiperidin-1-yl]-3-methyl-2,4-dioxopyrimidin-1-yl]methyl]-2-ethenylpenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 144867733 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | (2Z)-3-[[6-[(3R)-3-aminopiperidin-1-yl]-3-methyl-2,4-dioxopyrimidin-1-yl]methyl]-2-ethenylpenta-2,4-dienenitrile |
| SMILES | C=C/C(C#N)=C(\C=C)Cn1c(N2CCC[C@@H](N)C2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C18H23N5O2/c1-4-13(10-19)14(5-2)11-23-16(9-17(24)21(3)18(23)25)22-8-6-7-15(20)12-22/h4-5,9,15H,1-2,6-8,11-12,20H2,3H3/b14-13-/t15-/m1/s1 |
| InChIKey | RBNOWANDDFGEIF-SEWDUPMJSA-N |
| XLogP | 0.67 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|