C17H22N4O2 — CID 72707536
6-[(3R)-3-aminopiperidin-1-yl]-1,3-bis(but-2-ynyl)pyrimidine-2,4-dione (PubChem CID 72707536) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 6-[(3R)-3-aminopiperidin-1-yl]-1,3-bis(but-2-ynyl)pyrimidine-2,4-dione.
| Compound Name | 6-[(3R)-3-aminopiperidin-1-yl]-1,3-bis(but-2-ynyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 72707536 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 6-[(3R)-3-aminopiperidin-1-yl]-1,3-bis(but-2-ynyl)pyrimidine-2,4-dione |
| SMILES | CC#CCn1c(N2CCC[C@@H](N)C2)cc(=O)n(CC#CC)c1=O |
| InChI | InChI=1S/C17H22N4O2/c1-3-5-10-20-15(19-9-7-8-14(18)13-19)12-16(22)21(17(20)23)11-6-4-2/h12,14H,7-11,13,18H2,1-2H3/t14-/m1/s1 |
| InChIKey | OLQXVSOYOOMEQI-CQSZACIVSA-N |
| XLogP | -0.02 |
| TPSA | 73.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|