C14H20N4O2 — CID 72707535
6-[(3R)-3-aminopiperidin-1-yl]-1-but-2-ynyl-3-methylpyrimidine-2,4-dione (PubChem CID 72707535) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 6-[(3R)-3-aminopiperidin-1-yl]-1-but-2-ynyl-3-methylpyrimidine-2,4-dione.
| Compound Name | 6-[(3R)-3-aminopiperidin-1-yl]-1-but-2-ynyl-3-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 72707535 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 6-[(3R)-3-aminopiperidin-1-yl]-1-but-2-ynyl-3-methylpyrimidine-2,4-dione |
| SMILES | CC#CCn1c(N2CCC[C@@H](N)C2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C14H20N4O2/c1-3-4-8-18-12(9-13(19)16(2)14(18)20)17-7-5-6-11(15)10-17/h9,11H,5-8,10,15H2,1-2H3/t11-/m1/s1 |
| InChIKey | UEUAULUPWUEHIO-LLVKDONJSA-N |
| XLogP | -0.50 |
| TPSA | 73.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|