C16H19IN4O2 — CID 11350799
6-(3-aminopiperidin-1-yl)-1-[(2-iodophenyl)methyl]pyrimidine-2,4-dione (PubChem CID 11350799) has the molecular formula C16H19IN4O2 and a molecular weight of 426.26 g/mol. Its IUPAC name is 6-(3-aminopiperidin-1-yl)-1-[(2-iodophenyl)methyl]pyrimidine-2,4-dione.
| Compound Name | 6-(3-aminopiperidin-1-yl)-1-[(2-iodophenyl)methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11350799 |
| Molecular Formula | C16H19IN4O2 |
| Molecular Weight | 426.26 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | 6-(3-aminopiperidin-1-yl)-1-[(2-iodophenyl)methyl]pyrimidine-2,4-dione |
| SMILES | NC1CCCN(c2cc(=O)[nH]c(=O)n2Cc2ccccc2I)C1 |
| InChI | InChI=1S/C16H19IN4O2/c17-13-6-2-1-4-11(13)9-21-15(8-14(22)19-16(21)23)20-7-3-5-12(18)10-20/h1-2,4,6,8,12H,3,5,7,9-10,18H2,(H,19,22,23) |
| InChIKey | SHWTVSFPUGCFIH-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|