C21H26N6O — CID 158433617
7-[(3R)-3-aminopiperidin-1-yl]-1-[(2-isocyanophenyl)methyl]-5-methyl-3H-imidazo[4,5-b]pyridin-2-one;methane (PubChem CID 158433617) has the molecular formula C21H26N6O and a molecular weight of 378.48 g/mol. Its IUPAC name is 7-[(3R)-3-aminopiperidin-1-yl]-1-[(2-isocyanophenyl)methyl]-5-methyl-3H-imidazo[4,5-b]pyridin-2-one;methane.
| Compound Name | 7-[(3R)-3-aminopiperidin-1-yl]-1-[(2-isocyanophenyl)methyl]-5-methyl-3H-imidazo[4,5-b]pyridin-2-one;methane |
|---|---|
| PubChem CID | 158433617 |
| Molecular Formula | C21H26N6O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 7-[(3R)-3-aminopiperidin-1-yl]-1-[(2-isocyanophenyl)methyl]-5-methyl-3H-imidazo[4,5-b]pyridin-2-one;methane |
| SMILES | C.[C-]#[N+]c1ccccc1Cn1c(=O)[nH]c2nc(C)cc(N3CCC[C@@H](N)C3)c21 |
| InChI | InChI=1S/C20H22N6O.CH4/c1-13-10-17(25-9-5-7-15(21)12-25)18-19(23-13)24-20(27)26(18)11-14-6-3-4-8-16(14)22-2;/h3-4,6,8,10,15H,5,7,9,11-12,21H2,1H3,(H,23,24,27);1H4/t15-;/m1./s1 |
| InChIKey | HBYOBDOIAQLMOK-XFULWGLBSA-N |
| XLogP | 3.20 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|