C16H12N2O2 — CID 82344597
2-[(5-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]benzonitrile (PubChem CID 82344597) has the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. Its IUPAC name is 2-[(5-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]benzonitrile.
| Compound Name | 2-[(5-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 82344597 |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-[(5-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]benzonitrile |
| SMILES | Cc1ccc2oc(=O)n(Cc3ccccc3C#N)c2c1 |
| InChI | InChI=1S/C16H12N2O2/c1-11-6-7-15-14(8-11)18(16(19)20-15)10-13-5-3-2-4-12(13)9-17/h2-8H,10H2,1H3 |
| InChIKey | GGNLXHOGCOAGDZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 58.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |