C11H6ClN3O4S — CID 79764037
3-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-nitro-1,3-benzoxazol-2-one (PubChem CID 79764037) has the molecular formula C11H6ClN3O4S and a molecular weight of 311.71 g/mol. Its IUPAC name is 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-nitro-1,3-benzoxazol-2-one.
| Compound Name | 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-nitro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 79764037 |
| Molecular Formula | C11H6ClN3O4S |
| Molecular Weight | 311.71 g/mol |
| Exact Mass | 310.98 |
| IUPAC Name | 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-nitro-1,3-benzoxazol-2-one |
| SMILES | O=c1oc2ccc([N+](=O)[O-])cc2n1Cc1cnc(Cl)s1 |
| InChI | InChI=1S/C11H6ClN3O4S/c12-10-13-4-7(20-10)5-14-8-3-6(15(17)18)1-2-9(8)19-11(14)16/h1-4H,5H2 |
| InChIKey | HPDFQAYPZHAODY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 91.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.71 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|