C14H14N4O5 — CID 39049287
3-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl]-5-nitro-1,3-benzoxazol-2-one (PubChem CID 39049287) has the molecular formula C14H14N4O5 and a molecular weight of 318.29 g/mol. Its IUPAC name is 3-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl]-5-nitro-1,3-benzoxazol-2-one.
| Compound Name | 3-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl]-5-nitro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 39049287 |
| Molecular Formula | C14H14N4O5 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 3-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl]-5-nitro-1,3-benzoxazol-2-one |
| SMILES | CC(C)(C)c1noc(Cn2c(=O)oc3ccc([N+](=O)[O-])cc32)n1 |
| InChI | InChI=1S/C14H14N4O5/c1-14(2,3)12-15-11(23-16-12)7-17-9-6-8(18(20)21)4-5-10(9)22-13(17)19/h4-6H,7H2,1-3H3 |
| InChIKey | GOXQRMBVNYYMJN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 117.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|