C17H13ClN2O6 — CID 30805085
3-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-5-nitro-1,3-benzoxazol-2-one (PubChem CID 30805085) has the molecular formula C17H13ClN2O6 and a molecular weight of 376.75 g/mol. Its IUPAC name is 3-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-5-nitro-1,3-benzoxazol-2-one.
| Compound Name | 3-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-5-nitro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 30805085 |
| Molecular Formula | C17H13ClN2O6 |
| Molecular Weight | 376.75 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 3-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-5-nitro-1,3-benzoxazol-2-one |
| SMILES | O=c1oc2ccc([N+](=O)[O-])cc2n1Cc1cc(Cl)c2c(c1)OCCCO2 |
| InChI | InChI=1S/C17H13ClN2O6/c18-12-6-10(7-15-16(12)25-5-1-4-24-15)9-19-13-8-11(20(22)23)2-3-14(13)26-17(19)21/h2-3,6-8H,1,4-5,9H2 |
| InChIKey | WNHCYEZZBHFHIJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 96.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.75 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|