C17H16ClN3O5 — CID 27733728
1-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-3-(3-nitrophenyl)urea (PubChem CID 27733728) has the molecular formula C17H16ClN3O5 and a molecular weight of 377.78 g/mol. Its IUPAC name is 1-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-3-(3-nitrophenyl)urea.
| Compound Name | 1-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-3-(3-nitrophenyl)urea |
|---|---|
| PubChem CID | 27733728 |
| Molecular Formula | C17H16ClN3O5 |
| Molecular Weight | 377.78 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 1-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-3-(3-nitrophenyl)urea |
| SMILES | O=C(NCc1cc(Cl)c2c(c1)OCCCO2)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16ClN3O5/c18-14-7-11(8-15-16(14)26-6-2-5-25-15)10-19-17(22)20-12-3-1-4-13(9-12)21(23)24/h1,3-4,7-9H,2,5-6,10H2,(H2,19,20,22) |
| InChIKey | NEKBVSUBSYLWHD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.78 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|