C15H13ClN2O5S — CID 31557108
N-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-5-nitrothiophene-2-carboxamide (PubChem CID 31557108) has the molecular formula C15H13ClN2O5S and a molecular weight of 368.80 g/mol. Its IUPAC name is N-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-5-nitrothiophene-2-carboxamide.
| Compound Name | N-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-5-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 31557108 |
| Molecular Formula | C15H13ClN2O5S |
| Molecular Weight | 368.80 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | N-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-5-nitrothiophene-2-carboxamide |
| SMILES | O=C(NCc1cc(Cl)c2c(c1)OCCCO2)c1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C15H13ClN2O5S/c16-10-6-9(7-11-14(10)23-5-1-4-22-11)8-17-15(19)12-2-3-13(24-12)18(20)21/h2-3,6-7H,1,4-5,8H2,(H,17,19) |
| InChIKey | BGNHXWXHQVCJDY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.80 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|