C17H13ClN2O5 — CID 9400891
(E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-N-(3-nitrophenyl)prop-2-enamide (PubChem CID 9400891) has the molecular formula C17H13ClN2O5 and a molecular weight of 360.75 g/mol. Its IUPAC name is (E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-N-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-N-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 9400891 |
| Molecular Formula | C17H13ClN2O5 |
| Molecular Weight | 360.75 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | (E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-N-(3-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(Cl)c2c(c1)OCCO2)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H13ClN2O5/c18-14-8-11(9-15-17(14)25-7-6-24-15)4-5-16(21)19-12-2-1-3-13(10-12)20(22)23/h1-5,8-10H,6-7H2,(H,19,21)/b5-4+ |
| InChIKey | WSHMEFWQYDREQK-SNAWJCMRSA-N |
| XLogP | 3.67 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.75 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|