C19H18ClNO5S — CID 9072513
(E)-3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N-(3-methylsulfonylphenyl)prop-2-enamide (PubChem CID 9072513) has the molecular formula C19H18ClNO5S and a molecular weight of 407.88 g/mol. Its IUPAC name is (E)-3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N-(3-methylsulfonylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N-(3-methylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 9072513 |
| Molecular Formula | C19H18ClNO5S |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | (E)-3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N-(3-methylsulfonylphenyl)prop-2-enamide |
| SMILES | CS(=O)(=O)c1cccc(NC(=O)/C=C/c2cc(Cl)c3c(c2)OCCCO3)c1 |
| InChI | InChI=1S/C19H18ClNO5S/c1-27(23,24)15-5-2-4-14(12-15)21-18(22)7-6-13-10-16(20)19-17(11-13)25-8-3-9-26-19/h2,4-7,10-12H,3,8-9H2,1H3,(H,21,22)/b7-6+ |
| InChIKey | IAFSELDFQIVKBD-VOTSOKGWSA-N |
| XLogP | 3.56 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|