C21H23ClN2O6S — CID 16562986
(E)-3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]prop-2-enamide (PubChem CID 16562986) has the molecular formula C21H23ClN2O6S and a molecular weight of 466.94 g/mol. Its IUPAC name is (E)-3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]prop-2-enamide.
| Compound Name | (E)-3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 16562986 |
| Molecular Formula | C21H23ClN2O6S |
| Molecular Weight | 466.94 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | (E)-3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]prop-2-enamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)C)cc1NC(=O)/C=C/c1cc(Cl)c2c(c1)OCCCO2 |
| InChI | InChI=1S/C21H23ClN2O6S/c1-24(2)31(26,27)15-6-7-18(28-3)17(13-15)23-20(25)8-5-14-11-16(22)21-19(12-14)29-9-4-10-30-21/h5-8,11-13H,4,9-10H2,1-3H3,(H,23,25)/b8-5+ |
| InChIKey | ASAXJEVQCXUJPE-VMPITWQZSA-N |
| XLogP | 3.41 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.94 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|