C20H20ClNO4 — CID 9192306
(E)-3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N-(2-methoxy-5-methylphenyl)prop-2-enamide (PubChem CID 9192306) has the molecular formula C20H20ClNO4 and a molecular weight of 373.84 g/mol. Its IUPAC name is (E)-3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N-(2-methoxy-5-methylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N-(2-methoxy-5-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 9192306 |
| Molecular Formula | C20H20ClNO4 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | (E)-3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N-(2-methoxy-5-methylphenyl)prop-2-enamide |
| SMILES | COc1ccc(C)cc1NC(=O)/C=C/c1cc(Cl)c2c(c1)OCCCO2 |
| InChI | InChI=1S/C20H20ClNO4/c1-13-4-6-17(24-2)16(10-13)22-19(23)7-5-14-11-15(21)20-18(12-14)25-8-3-9-26-20/h4-7,10-12H,3,8-9H2,1-2H3,(H,22,23)/b7-5+ |
| InChIKey | KWIAEVCJRSLWNF-FNORWQNLSA-N |
| XLogP | 4.47 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|