C20H19ClN2O7S — CID 27777183
[2-oxo-2-(3-sulfamoylanilino)ethyl] (E)-3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)prop-2-enoate (PubChem CID 27777183) has the molecular formula C20H19ClN2O7S and a molecular weight of 466.90 g/mol. Its IUPAC name is [2-oxo-2-(3-sulfamoylanilino)ethyl] (E)-3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)prop-2-enoate.
| Compound Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] (E)-3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)prop-2-enoate |
|---|---|
| PubChem CID | 27777183 |
| Molecular Formula | C20H19ClN2O7S |
| Molecular Weight | 466.90 g/mol |
| Exact Mass | 466.06 |
| IUPAC Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] (E)-3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)prop-2-enoate |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)COC(=O)/C=C/c2cc(Cl)c3c(c2)OCCCO3)c1 |
| InChI | InChI=1S/C20H19ClN2O7S/c21-16-9-13(10-17-20(16)29-8-2-7-28-17)5-6-19(25)30-12-18(24)23-14-3-1-4-15(11-14)31(22,26)27/h1,3-6,9-11H,2,7-8,12H2,(H,23,24)(H2,22,26,27)/b6-5+ |
| InChIKey | NNCLCEZJCDMVKP-AATRIKPKSA-N |
| XLogP | 2.34 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.90 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|