C18H15ClO4 — CID 9192009
phenyl (E)-3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)prop-2-enoate (PubChem CID 9192009) has the molecular formula C18H15ClO4 and a molecular weight of 330.77 g/mol. Its IUPAC name is phenyl (E)-3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)prop-2-enoate.
| Compound Name | phenyl (E)-3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)prop-2-enoate |
|---|---|
| PubChem CID | 9192009 |
| Molecular Formula | C18H15ClO4 |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | phenyl (E)-3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1cc(Cl)c2c(c1)OCCCO2)Oc1ccccc1 |
| InChI | InChI=1S/C18H15ClO4/c19-15-11-13(12-16-18(15)22-10-4-9-21-16)7-8-17(20)23-14-5-2-1-3-6-14/h1-3,5-8,11-12H,4,9-10H2/b8-7+ |
| InChIKey | DFERNRZKLCVQHT-BQYQJAHWSA-N |
| XLogP | 4.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|