C13H13N3O6 — CID 35353500
3-(2-morpholin-4-yl-2-oxoethyl)-5-nitro-1,3-benzoxazol-2-one (PubChem CID 35353500) has the molecular formula C13H13N3O6 and a molecular weight of 307.26 g/mol. Its IUPAC name is 3-(2-morpholin-4-yl-2-oxoethyl)-5-nitro-1,3-benzoxazol-2-one.
| Compound Name | 3-(2-morpholin-4-yl-2-oxoethyl)-5-nitro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 35353500 |
| Molecular Formula | C13H13N3O6 |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 3-(2-morpholin-4-yl-2-oxoethyl)-5-nitro-1,3-benzoxazol-2-one |
| SMILES | O=C(Cn1c(=O)oc2ccc([N+](=O)[O-])cc21)N1CCOCC1 |
| InChI | InChI=1S/C13H13N3O6/c17-12(14-3-5-21-6-4-14)8-15-10-7-9(16(19)20)1-2-11(10)22-13(15)18/h1-2,7H,3-6,8H2 |
| InChIKey | FXNRNGDPIMDILP-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 107.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|