C19H16F2N4O7S — CID 55389656
3-[2-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-6-nitro-1,3-benzoxazol-2-one (PubChem CID 55389656) has the molecular formula C19H16F2N4O7S and a molecular weight of 482.42 g/mol. Its IUPAC name is 3-[2-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-6-nitro-1,3-benzoxazol-2-one.
| Compound Name | 3-[2-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-6-nitro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 55389656 |
| Molecular Formula | C19H16F2N4O7S |
| Molecular Weight | 482.42 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | 3-[2-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-6-nitro-1,3-benzoxazol-2-one |
| SMILES | O=C(Cn1c(=O)oc2cc([N+](=O)[O-])ccc21)N1CCN(S(=O)(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C19H16F2N4O7S/c20-12-1-3-14(21)17(9-12)33(30,31)23-7-5-22(6-8-23)18(26)11-24-15-4-2-13(25(28)29)10-16(15)32-19(24)27/h1-4,9-10H,5-8,11H2 |
| InChIKey | BGBZZKBLGIPPTD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 135.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.42 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|