C19H16F3N3O5S — CID 134028578
3-[2-oxo-2-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]ethyl]-1,3-benzoxazol-2-one (PubChem CID 134028578) has the molecular formula C19H16F3N3O5S and a molecular weight of 455.41 g/mol. Its IUPAC name is 3-[2-oxo-2-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]ethyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-[2-oxo-2-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]ethyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 134028578 |
| Molecular Formula | C19H16F3N3O5S |
| Molecular Weight | 455.41 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | 3-[2-oxo-2-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]ethyl]-1,3-benzoxazol-2-one |
| SMILES | O=C(Cn1c(=O)oc2ccccc21)N1CCN(S(=O)(=O)c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C19H16F3N3O5S/c20-12-5-6-15(18(22)17(12)21)31(28,29)24-9-7-23(8-10-24)16(26)11-25-13-3-1-2-4-14(13)30-19(25)27/h1-6H,7-11H2 |
| InChIKey | PAEAQPSYJHAJGK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 92.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|