C11H13N3O6S — CID 86851415
N-[3-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)propyl]methanesulfonamide (PubChem CID 86851415) has the molecular formula C11H13N3O6S and a molecular weight of 315.31 g/mol. Its IUPAC name is N-[3-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)propyl]methanesulfonamide.
| Compound Name | N-[3-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)propyl]methanesulfonamide |
|---|---|
| PubChem CID | 86851415 |
| Molecular Formula | C11H13N3O6S |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | N-[3-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCn1c(=O)oc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C11H13N3O6S/c1-21(18,19)12-5-2-6-13-9-7-8(14(16)17)3-4-10(9)20-11(13)15/h3-4,7,12H,2,5-6H2,1H3 |
| InChIKey | KSKXGGUVNBFGRD-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|