C11H13ClN2O4S — CID 154747701
N-[3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propyl]methanesulfonamide (PubChem CID 154747701) has the molecular formula C11H13ClN2O4S and a molecular weight of 304.75 g/mol. Its IUPAC name is N-[3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propyl]methanesulfonamide.
| Compound Name | N-[3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propyl]methanesulfonamide |
|---|---|
| PubChem CID | 154747701 |
| Molecular Formula | C11H13ClN2O4S |
| Molecular Weight | 304.75 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | N-[3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCn1c(=O)oc2cc(Cl)ccc21 |
| InChI | InChI=1S/C11H13ClN2O4S/c1-19(16,17)13-5-2-6-14-9-4-3-8(12)7-10(9)18-11(14)15/h3-4,7,13H,2,5-6H2,1H3 |
| InChIKey | LVEZXMKTUYHDBT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.75 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|