C20H20N4O7 — CID 86964787
5-(2,5-dimethylfuran-3-yl)-5-methyl-3-[3-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)propyl]imidazolidine-2,4-dione (PubChem CID 86964787) has the molecular formula C20H20N4O7 and a molecular weight of 428.40 g/mol. Its IUPAC name is 5-(2,5-dimethylfuran-3-yl)-5-methyl-3-[3-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)propyl]imidazolidine-2,4-dione.
| Compound Name | 5-(2,5-dimethylfuran-3-yl)-5-methyl-3-[3-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 86964787 |
| Molecular Formula | C20H20N4O7 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 5-(2,5-dimethylfuran-3-yl)-5-methyl-3-[3-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)propyl]imidazolidine-2,4-dione |
| SMILES | Cc1cc(C2(C)NC(=O)N(CCCn3c(=O)oc4ccc([N+](=O)[O-])cc43)C2=O)c(C)o1 |
| InChI | InChI=1S/C20H20N4O7/c1-11-9-14(12(2)30-11)20(3)17(25)23(18(26)21-20)8-4-7-22-15-10-13(24(28)29)5-6-16(15)31-19(22)27/h5-6,9-10H,4,7-8H2,1-3H3,(H,21,26) |
| InChIKey | OCPXKIUAXLVLEM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 140.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|