C14H11N3O6 — CID 35353534
N-(furan-2-ylmethyl)-2-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)acetamide (PubChem CID 35353534) has the molecular formula C14H11N3O6 and a molecular weight of 317.26 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 35353534 |
| Molecular Formula | C14H11N3O6 |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)acetamide |
| SMILES | O=C(Cn1c(=O)oc2ccc([N+](=O)[O-])cc21)NCc1ccco1 |
| InChI | InChI=1S/C14H11N3O6/c18-13(15-7-10-2-1-5-22-10)8-16-11-6-9(17(20)21)3-4-12(11)23-14(16)19/h1-6H,7-8H2,(H,15,18) |
| InChIKey | ZNNBGVSPGOCYIY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|