C12H14N4O5 — CID 63579033
4-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)pentanehydrazide (PubChem CID 63579033) has the molecular formula C12H14N4O5 and a molecular weight of 294.27 g/mol. Its IUPAC name is 4-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)pentanehydrazide.
| Compound Name | 4-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)pentanehydrazide |
|---|---|
| PubChem CID | 63579033 |
| Molecular Formula | C12H14N4O5 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 4-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)pentanehydrazide |
| SMILES | CC(CCC(=O)NN)n1c(=O)oc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C12H14N4O5/c1-7(2-5-11(17)14-13)15-9-6-8(16(19)20)3-4-10(9)21-12(15)18/h3-4,6-7H,2,5,13H2,1H3,(H,14,17) |
| InChIKey | RNMVKVJDRFYPMG-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 133.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|