4-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)pentanoic acid

C12H12N2O6 — CID 62213269

IUPAC4-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)pentanoic acid
SMILESCC(CCC(=O)O)n1c(=O)oc2ccc([N+](=O)[O-])cc21
InChIInChI=1S/C12H12N2O6/c1-7(2-5-11(15)16)13-9-6-8(14(18)19)3-4-10(9)20-12(13)17/h3-4,6-7H,2,5H2,1H3,(H,15,16)
InChIKeyNGLRTSSSHCTCPT-UHFFFAOYSA-N
MW280.24 g/mol
LogP1.93
Rot. Bonds5

About 4-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)pentanoic acid

4-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)pentanoic acid (PubChem CID 62213269) has the molecular formula C12H12N2O6 and a molecular weight of 280.24 g/mol. Its IUPAC name is 4-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)pentanoic acid.

Molecular Properties

Compound Name4-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)pentanoic acid
PubChem CID62213269
Molecular FormulaC12H12N2O6
Molecular Weight280.24 g/mol
Exact Mass280.07
IUPAC Name4-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)pentanoic acid
SMILESCC(CCC(=O)O)n1c(=O)oc2ccc([N+](=O)[O-])cc21
InChIInChI=1S/C12H12N2O6/c1-7(2-5-11(15)16)13-9-6-8(14(18)19)3-4-10(9)20-12(13)17/h3-4,6-7H,2,5H2,1H3,(H,15,16)
InChIKeyNGLRTSSSHCTCPT-UHFFFAOYSA-N
XLogP1.93
TPSA115.58 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.24
LogP ≤ 51.93
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 4-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)pentanoic acid?
The IUPAC name of 4-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)pentanoic acid (CID 62213269) is 4-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)pentanoic acid.
What is the SMILES notation for 4-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)pentanoic acid?
The canonical SMILES for 4-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)pentanoic acid is CC(CCC(=O)O)n1c(=O)oc2ccc([N+](=O)[O-])cc21.
What is the InChIKey of 4-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)pentanoic acid?
The InChIKey is NGLRTSSSHCTCPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O6/c1-7(2-5-11(15)16)13-9-6-8(14(18)19)3-4-10(9)20-12(13)17/h3-4,6-7H,2,5H2,1H3,(H,15,16).
What are the key properties of 4-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)pentanoic acid?
4-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)pentanoic acid has a molecular weight of 280.24 g/mol, XLogP of 1.93, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-nitro-2-oxo-1,3-benzoxazol-3-yl)pentanoic acid is sourced from PubChem (CID 62213269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).