C19H19N5O4S2 — CID 86964795
3-[3-[[5-methyl-4-(2-thiophen-2-ylethyl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-5-nitro-1,3-benzoxazol-2-one (PubChem CID 86964795) has the molecular formula C19H19N5O4S2 and a molecular weight of 445.53 g/mol. Its IUPAC name is 3-[3-[[5-methyl-4-(2-thiophen-2-ylethyl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-5-nitro-1,3-benzoxazol-2-one.
| Compound Name | 3-[3-[[5-methyl-4-(2-thiophen-2-ylethyl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-5-nitro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 86964795 |
| Molecular Formula | C19H19N5O4S2 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | 3-[3-[[5-methyl-4-(2-thiophen-2-ylethyl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-5-nitro-1,3-benzoxazol-2-one |
| SMILES | Cc1nnc(SCCCn2c(=O)oc3ccc([N+](=O)[O-])cc32)n1CCc1cccs1 |
| InChI | InChI=1S/C19H19N5O4S2/c1-13-20-21-18(22(13)9-7-15-4-2-10-29-15)30-11-3-8-23-16-12-14(24(26)27)5-6-17(16)28-19(23)25/h2,4-6,10,12H,3,7-9,11H2,1H3 |
| InChIKey | LPGSJGIBFACVBO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 108.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|