C14H9N7O6S — CID 90683121
5-[(2,4-dinitrophenyl)methylsulfanyl]-1-(3-nitrophenyl)tetrazole (PubChem CID 90683121) has the molecular formula C14H9N7O6S and a molecular weight of 403.34 g/mol. Its IUPAC name is 5-[(2,4-dinitrophenyl)methylsulfanyl]-1-(3-nitrophenyl)tetrazole.
| Compound Name | 5-[(2,4-dinitrophenyl)methylsulfanyl]-1-(3-nitrophenyl)tetrazole |
|---|---|
| PubChem CID | 90683121 |
| Molecular Formula | C14H9N7O6S |
| Molecular Weight | 403.34 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | 5-[(2,4-dinitrophenyl)methylsulfanyl]-1-(3-nitrophenyl)tetrazole |
| SMILES | O=[N+]([O-])c1cccc(-n2nnnc2SCc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H9N7O6S/c22-19(23)11-3-1-2-10(6-11)18-14(15-16-17-18)28-8-9-4-5-12(20(24)25)7-13(9)21(26)27/h1-7H,8H2 |
| InChIKey | PZBIXBLQGZDPHG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 173.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|