C15H10N8O8S — CID 122191533
2-[(3,5-dinitrophenyl)methyl]-5-[(2,4-dinitrophenyl)methylsulfanyl]tetrazole (PubChem CID 122191533) has the molecular formula C15H10N8O8S and a molecular weight of 462.36 g/mol. Its IUPAC name is 2-[(3,5-dinitrophenyl)methyl]-5-[(2,4-dinitrophenyl)methylsulfanyl]tetrazole.
| Compound Name | 2-[(3,5-dinitrophenyl)methyl]-5-[(2,4-dinitrophenyl)methylsulfanyl]tetrazole |
|---|---|
| PubChem CID | 122191533 |
| Molecular Formula | C15H10N8O8S |
| Molecular Weight | 462.36 g/mol |
| Exact Mass | 462.03 |
| IUPAC Name | 2-[(3,5-dinitrophenyl)methyl]-5-[(2,4-dinitrophenyl)methylsulfanyl]tetrazole |
| SMILES | O=[N+]([O-])c1cc(Cn2nnc(SCc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])n2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H10N8O8S/c24-20(25)11-2-1-10(14(6-11)23(30)31)8-32-15-16-18-19(17-15)7-9-3-12(21(26)27)5-13(4-9)22(28)29/h1-6H,7-8H2 |
| InChIKey | LLLLBNMDMAVQNF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 216.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|