C15H10N4O4S2 — CID 127045767
2-[(2,4-dinitrophenyl)methylsulfanyl]-5-phenyl-1,3,4-thiadiazole (PubChem CID 127045767) has the molecular formula C15H10N4O4S2 and a molecular weight of 374.40 g/mol. Its IUPAC name is 2-[(2,4-dinitrophenyl)methylsulfanyl]-5-phenyl-1,3,4-thiadiazole.
| Compound Name | 2-[(2,4-dinitrophenyl)methylsulfanyl]-5-phenyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 127045767 |
| Molecular Formula | C15H10N4O4S2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | 2-[(2,4-dinitrophenyl)methylsulfanyl]-5-phenyl-1,3,4-thiadiazole |
| SMILES | O=[N+]([O-])c1ccc(CSc2nnc(-c3ccccc3)s2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H10N4O4S2/c20-18(21)12-7-6-11(13(8-12)19(22)23)9-24-15-17-16-14(25-15)10-4-2-1-3-5-10/h1-8H,9H2 |
| InChIKey | XONAMVKAYMLCFT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 112.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|